C20H21N3O6 — CID 139373838
benzyl 4-[(4-nitrophenoxy)carbonylamino]piperidine-1-carboxylate (PubChem CID 139373838) has the molecular formula C20H21N3O6 and a molecular weight of 399.40 g/mol. Its IUPAC name is benzyl 4-[(4-nitrophenoxy)carbonylamino]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[(4-nitrophenoxy)carbonylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 139373838 |
| Molecular Formula | C20H21N3O6 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | benzyl 4-[(4-nitrophenoxy)carbonylamino]piperidine-1-carboxylate |
| SMILES | O=C(NC1CCN(C(=O)OCc2ccccc2)CC1)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H21N3O6/c24-19(29-18-8-6-17(7-9-18)23(26)27)21-16-10-12-22(13-11-16)20(25)28-14-15-4-2-1-3-5-15/h1-9,16H,10-14H2,(H,21,24) |
| InChIKey | AHEFRMGVQAUVJS-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|