C20H19FN2O6 — CID 129278094
benzyl (3S,4R)-3-fluoro-4-(4-nitrobenzoyl)oxypiperidine-1-carboxylate (PubChem CID 129278094) has the molecular formula C20H19FN2O6 and a molecular weight of 402.38 g/mol. Its IUPAC name is benzyl (3S,4R)-3-fluoro-4-(4-nitrobenzoyl)oxypiperidine-1-carboxylate.
| Compound Name | benzyl (3S,4R)-3-fluoro-4-(4-nitrobenzoyl)oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 129278094 |
| Molecular Formula | C20H19FN2O6 |
| Molecular Weight | 402.38 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | benzyl (3S,4R)-3-fluoro-4-(4-nitrobenzoyl)oxypiperidine-1-carboxylate |
| SMILES | O=C(O[C@@H]1CCN(C(=O)OCc2ccccc2)C[C@@H]1F)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H19FN2O6/c21-17-12-22(20(25)28-13-14-4-2-1-3-5-14)11-10-18(17)29-19(24)15-6-8-16(9-7-15)23(26)27/h1-9,17-18H,10-13H2/t17-,18+/m0/s1 |
| InChIKey | QSNGHJOBYIQNGZ-ZWKOTPCHSA-N |
| XLogP | 3.50 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|