C21H20N2O6 — CID 162785994
benzyl (1R,4R)-5-(4-nitrobenzoyl)oxy-2-azabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 162785994) has the molecular formula C21H20N2O6 and a molecular weight of 396.40 g/mol. Its IUPAC name is benzyl (1R,4R)-5-(4-nitrobenzoyl)oxy-2-azabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | benzyl (1R,4R)-5-(4-nitrobenzoyl)oxy-2-azabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 162785994 |
| Molecular Formula | C21H20N2O6 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | benzyl (1R,4R)-5-(4-nitrobenzoyl)oxy-2-azabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | O=C(OC1C[C@H]2C[C@@H]1CN2C(=O)OCc1ccccc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H20N2O6/c24-20(15-6-8-17(9-7-15)23(26)27)29-19-11-18-10-16(19)12-22(18)21(25)28-13-14-4-2-1-3-5-14/h1-9,16,18-19H,10-13H2/t16-,18-,19?/m1/s1 |
| InChIKey | DGJKOPCJZBVBTP-SYUDBMKNSA-N |
| XLogP | 3.55 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|