C22H21N3O8 — CID 141283586
6-(4-nitrobenzoyl)oxy-1-phenylmethoxycarbonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylic acid (PubChem CID 141283586) has the molecular formula C22H21N3O8 and a molecular weight of 455.42 g/mol. Its IUPAC name is 6-(4-nitrobenzoyl)oxy-1-phenylmethoxycarbonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylic acid.
| Compound Name | 6-(4-nitrobenzoyl)oxy-1-phenylmethoxycarbonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylic acid |
|---|---|
| PubChem CID | 141283586 |
| Molecular Formula | C22H21N3O8 |
| Molecular Weight | 455.42 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 6-(4-nitrobenzoyl)oxy-1-phenylmethoxycarbonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylic acid |
| SMILES | O=C(OC1CN(C(=O)O)C2CCN(C(=O)OCc3ccccc3)C12)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H21N3O8/c26-20(15-6-8-16(9-7-15)25(30)31)33-18-12-24(21(27)28)17-10-11-23(19(17)18)22(29)32-13-14-4-2-1-3-5-14/h1-9,17-19H,10-13H2,(H,27,28) |
| InChIKey | TZXREJVYOKMETC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 139.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|