C22H24N2O4 — CID 169030309
[(1R,2S)-2-(3-phenylazetidin-1-yl)cyclohexyl] 4-nitrobenzoate (PubChem CID 169030309) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is [(1R,2S)-2-(3-phenylazetidin-1-yl)cyclohexyl] 4-nitrobenzoate.
| Compound Name | [(1R,2S)-2-(3-phenylazetidin-1-yl)cyclohexyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 169030309 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | [(1R,2S)-2-(3-phenylazetidin-1-yl)cyclohexyl] 4-nitrobenzoate |
| SMILES | O=C(O[C@@H]1CCCC[C@@H]1N1CC(c2ccccc2)C1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H24N2O4/c25-22(17-10-12-19(13-11-17)24(26)27)28-21-9-5-4-8-20(21)23-14-18(15-23)16-6-2-1-3-7-16/h1-3,6-7,10-13,18,20-21H,4-5,8-9,14-15H2/t20-,21+/m0/s1 |
| InChIKey | ZMXJAQHHWWDQHC-LEWJYISDSA-N |
| XLogP | 4.16 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|