C23H20FNO4 — CID 139705864
[(1S,2S)-2-(2-fluoronaphthalen-1-yl)cyclohexyl] 4-nitrobenzoate (PubChem CID 139705864) has the molecular formula C23H20FNO4 and a molecular weight of 393.41 g/mol. Its IUPAC name is [(1S,2S)-2-(2-fluoronaphthalen-1-yl)cyclohexyl] 4-nitrobenzoate.
| Compound Name | [(1S,2S)-2-(2-fluoronaphthalen-1-yl)cyclohexyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 139705864 |
| Molecular Formula | C23H20FNO4 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | [(1S,2S)-2-(2-fluoronaphthalen-1-yl)cyclohexyl] 4-nitrobenzoate |
| SMILES | O=C(O[C@H]1CCCC[C@H]1c1c(F)ccc2ccccc12)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H20FNO4/c24-20-14-11-15-5-1-2-6-18(15)22(20)19-7-3-4-8-21(19)29-23(26)16-9-12-17(13-10-16)25(27)28/h1-2,5-6,9-14,19,21H,3-4,7-8H2/t19-,21+/m1/s1 |
| InChIKey | PABRWTZWHCYXLS-CTNGQTDRSA-N |
| XLogP | 5.77 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|