C26H27NO6 — CID 139705997
[(1R,2R)-2-[2-(2-methoxyethoxy)naphthalen-1-yl]cyclohexyl] 4-nitrobenzoate (PubChem CID 139705997) has the molecular formula C26H27NO6 and a molecular weight of 449.50 g/mol. Its IUPAC name is [(1R,2R)-2-[2-(2-methoxyethoxy)naphthalen-1-yl]cyclohexyl] 4-nitrobenzoate.
| Compound Name | [(1R,2R)-2-[2-(2-methoxyethoxy)naphthalen-1-yl]cyclohexyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 139705997 |
| Molecular Formula | C26H27NO6 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | [(1R,2R)-2-[2-(2-methoxyethoxy)naphthalen-1-yl]cyclohexyl] 4-nitrobenzoate |
| SMILES | COCCOc1ccc2ccccc2c1[C@H]1CCCC[C@H]1OC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H27NO6/c1-31-16-17-32-24-15-12-18-6-2-3-7-21(18)25(24)22-8-4-5-9-23(22)33-26(28)19-10-13-20(14-11-19)27(29)30/h2-3,6-7,10-15,22-23H,4-5,8-9,16-17H2,1H3/t22-,23+/m0/s1 |
| InChIKey | ALZAHTVZRUMKOB-XZOQPEGZSA-N |
| XLogP | 5.66 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|