C18H22O2 — CID 139705954
cis-(1S,2S)-2-(2-ethoxynaphthalen-1-yl)cyclohexan-1-ol (PubChem CID 139705954) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is cis-(1S,2S)-2-(2-ethoxynaphthalen-1-yl)cyclohexan-1-ol.
| Compound Name | cis-(1S,2S)-2-(2-ethoxynaphthalen-1-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 139705954 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | cis-(1S,2S)-2-(2-ethoxynaphthalen-1-yl)cyclohexan-1-ol |
| SMILES | CCOc1ccc2ccccc2c1[C@@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C18H22O2/c1-2-20-17-12-11-13-7-3-4-8-14(13)18(17)15-9-5-6-10-16(15)19/h3-4,7-8,11-12,15-16,19H,2,5-6,9-10H2,1H3/t15-,16+/m1/s1 |
| InChIKey | IKSITEMVWVORMH-CVEARBPZSA-N |
| XLogP | 4.26 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |