C22H28O — CID 139705994
cis-(1R,2R)-2-(2-cyclohexylnaphthalen-1-yl)cyclohexan-1-ol (PubChem CID 139705994) has the molecular formula C22H28O and a molecular weight of 308.46 g/mol. Its IUPAC name is cis-(1R,2R)-2-(2-cyclohexylnaphthalen-1-yl)cyclohexan-1-ol.
| Compound Name | cis-(1R,2R)-2-(2-cyclohexylnaphthalen-1-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 139705994 |
| Molecular Formula | C22H28O |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | cis-(1R,2R)-2-(2-cyclohexylnaphthalen-1-yl)cyclohexan-1-ol |
| SMILES | O[C@@H]1CCCC[C@@H]1c1c(C2CCCCC2)ccc2ccccc12 |
| InChI | InChI=1S/C22H28O/c23-21-13-7-6-12-20(21)22-18-11-5-4-10-17(18)14-15-19(22)16-8-2-1-3-9-16/h4-5,10-11,14-16,20-21,23H,1-3,6-9,12-13H2/t20-,21+/m0/s1 |
| InChIKey | MCSVITWKSQAWMY-LEWJYISDSA-N |
| XLogP | 5.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |