C21H26O3 — CID 139705959
cis-(1S,2S)-2-[2-[(2S)-oxan-2-yl]oxynaphthalen-1-yl]cyclohexan-1-ol (PubChem CID 139705959) has the molecular formula C21H26O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is cis-(1S,2S)-2-[2-[(2S)-oxan-2-yl]oxynaphthalen-1-yl]cyclohexan-1-ol.
| Compound Name | cis-(1S,2S)-2-[2-[(2S)-oxan-2-yl]oxynaphthalen-1-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 139705959 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | cis-(1S,2S)-2-[2-[(2S)-oxan-2-yl]oxynaphthalen-1-yl]cyclohexan-1-ol |
| SMILES | O[C@H]1CCCC[C@H]1c1c(O[C@H]2CCCCO2)ccc2ccccc12 |
| InChI | InChI=1S/C21H26O3/c22-18-10-4-3-9-17(18)21-16-8-2-1-7-15(16)12-13-19(21)24-20-11-5-6-14-23-20/h1-2,7-8,12-13,17-18,20,22H,3-6,9-11,14H2/t17-,18+,20+/m1/s1 |
| InChIKey | PTXLETKSMLGQTI-HBFSDRIKSA-N |
| XLogP | 4.76 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |