C17H20O — CID 139705882
cis-(1S,2S)-2-(2-methylnaphthalen-1-yl)cyclohexan-1-ol (PubChem CID 139705882) has the molecular formula C17H20O and a molecular weight of 240.35 g/mol. Its IUPAC name is cis-(1S,2S)-2-(2-methylnaphthalen-1-yl)cyclohexan-1-ol.
| Compound Name | cis-(1S,2S)-2-(2-methylnaphthalen-1-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 139705882 |
| Molecular Formula | C17H20O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | cis-(1S,2S)-2-(2-methylnaphthalen-1-yl)cyclohexan-1-ol |
| SMILES | Cc1ccc2ccccc2c1[C@@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C17H20O/c1-12-10-11-13-6-2-3-7-14(13)17(12)15-8-4-5-9-16(15)18/h2-3,6-7,10-11,15-16,18H,4-5,8-9H2,1H3/t15-,16+/m1/s1 |
| InChIKey | FVXZPKUOVCBNQO-CVEARBPZSA-N |
| XLogP | 4.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |