C18H22O2S — CID 139705915
cis-(1S,2S)-2-[2-(methylsulfanylmethoxy)naphthalen-1-yl]cyclohexan-1-ol (PubChem CID 139705915) has the molecular formula C18H22O2S and a molecular weight of 302.44 g/mol. Its IUPAC name is cis-(1S,2S)-2-[2-(methylsulfanylmethoxy)naphthalen-1-yl]cyclohexan-1-ol.
| Compound Name | cis-(1S,2S)-2-[2-(methylsulfanylmethoxy)naphthalen-1-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 139705915 |
| Molecular Formula | C18H22O2S |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | cis-(1S,2S)-2-[2-(methylsulfanylmethoxy)naphthalen-1-yl]cyclohexan-1-ol |
| SMILES | CSCOc1ccc2ccccc2c1[C@@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C18H22O2S/c1-21-12-20-17-11-10-13-6-2-3-7-14(13)18(17)15-8-4-5-9-16(15)19/h2-3,6-7,10-11,15-16,19H,4-5,8-9,12H2,1H3/t15-,16+/m1/s1 |
| InChIKey | LXKNPEFABDGCHA-CVEARBPZSA-N |
| XLogP | 4.56 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|