C18H24O5 — CID 121005777
1-[3,4-bis(oxan-2-yloxy)phenyl]ethanone (PubChem CID 121005777) has the molecular formula C18H24O5 and a molecular weight of 320.39 g/mol. Its IUPAC name is 1-[3,4-bis(oxan-2-yloxy)phenyl]ethanone.
| Compound Name | 1-[3,4-bis(oxan-2-yloxy)phenyl]ethanone |
|---|---|
| PubChem CID | 121005777 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 1-[3,4-bis(oxan-2-yloxy)phenyl]ethanone |
| SMILES | CC(=O)c1ccc(OC2CCCCO2)c(OC2CCCCO2)c1 |
| InChI | InChI=1S/C18H24O5/c1-13(19)14-8-9-15(22-17-6-2-4-10-20-17)16(12-14)23-18-7-3-5-11-21-18/h8-9,12,17-18H,2-7,10-11H2,1H3 |
| InChIKey | JXWRBHGEFQSZGS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |