C18H25NO4 — CID 118480196
5-[2-(tert-butylamino)acetyl]-2-(oxan-2-yloxy)benzaldehyde (PubChem CID 118480196) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is 5-[2-(tert-butylamino)acetyl]-2-(oxan-2-yloxy)benzaldehyde.
| Compound Name | 5-[2-(tert-butylamino)acetyl]-2-(oxan-2-yloxy)benzaldehyde |
|---|---|
| PubChem CID | 118480196 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 5-[2-(tert-butylamino)acetyl]-2-(oxan-2-yloxy)benzaldehyde |
| SMILES | CC(C)(C)NCC(=O)c1ccc(OC2CCCCO2)c(C=O)c1 |
| InChI | InChI=1S/C18H25NO4/c1-18(2,3)19-11-15(21)13-7-8-16(14(10-13)12-20)23-17-6-4-5-9-22-17/h7-8,10,12,17,19H,4-6,9,11H2,1-3H3 |
| InChIKey | QOHQLNLPBIWFPN-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|