C19H26O4 — CID 57467622
methyl 3-(3,3-dimethylbut-1-en-2-yl)-4-(oxan-2-yloxy)benzoate (PubChem CID 57467622) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is methyl 3-(3,3-dimethylbut-1-en-2-yl)-4-(oxan-2-yloxy)benzoate.
| Compound Name | methyl 3-(3,3-dimethylbut-1-en-2-yl)-4-(oxan-2-yloxy)benzoate |
|---|---|
| PubChem CID | 57467622 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | methyl 3-(3,3-dimethylbut-1-en-2-yl)-4-(oxan-2-yloxy)benzoate |
| SMILES | C=C(c1cc(C(=O)OC)ccc1OC1CCCCO1)C(C)(C)C |
| InChI | InChI=1S/C19H26O4/c1-13(19(2,3)4)15-12-14(18(20)21-5)9-10-16(15)23-17-8-6-7-11-22-17/h9-10,12,17H,1,6-8,11H2,2-5H3 |
| InChIKey | SQZQAKLNMNGLIR-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |