C24H24O4 — CID 10022408
methyl 7-[3-(oxan-2-yloxymethyl)phenyl]naphthalene-2-carboxylate (PubChem CID 10022408) has the molecular formula C24H24O4 and a molecular weight of 376.45 g/mol. Its IUPAC name is methyl 7-[3-(oxan-2-yloxymethyl)phenyl]naphthalene-2-carboxylate.
| Compound Name | methyl 7-[3-(oxan-2-yloxymethyl)phenyl]naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 10022408 |
| Molecular Formula | C24H24O4 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | methyl 7-[3-(oxan-2-yloxymethyl)phenyl]naphthalene-2-carboxylate |
| SMILES | COC(=O)c1ccc2ccc(-c3cccc(COC4CCCCO4)c3)cc2c1 |
| InChI | InChI=1S/C24H24O4/c1-26-24(25)21-11-9-18-8-10-20(14-22(18)15-21)19-6-4-5-17(13-19)16-28-23-7-2-3-12-27-23/h4-6,8-11,13-15,23H,2-3,7,12,16H2,1H3 |
| InChIKey | KDWZMVFHXWVQMW-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |