C12H15FO2 — CID 22446153
2-[(3-fluorophenyl)methoxy]oxane (PubChem CID 22446153) has the molecular formula C12H15FO2 and a molecular weight of 210.25 g/mol. Its IUPAC name is 2-[(3-fluorophenyl)methoxy]oxane.
| Compound Name | 2-[(3-fluorophenyl)methoxy]oxane |
|---|---|
| PubChem CID | 22446153 |
| Molecular Formula | C12H15FO2 |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 2-[(3-fluorophenyl)methoxy]oxane |
| SMILES | Fc1cccc(COC2CCCCO2)c1 |
| InChI | InChI=1S/C12H15FO2/c13-11-5-3-4-10(8-11)9-15-12-6-1-2-7-14-12/h3-5,8,12H,1-2,6-7,9H2 |
| InChIKey | VHFIVTIVNMXWPC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |