C12H15FO2 — CID 91656930
2-[(3-fluorophenyl)methoxymethyl]oxolane (PubChem CID 91656930) has the molecular formula C12H15FO2 and a molecular weight of 210.25 g/mol. Its IUPAC name is 2-[(3-fluorophenyl)methoxymethyl]oxolane.
| Compound Name | 2-[(3-fluorophenyl)methoxymethyl]oxolane |
|---|---|
| PubChem CID | 91656930 |
| Molecular Formula | C12H15FO2 |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 2-[(3-fluorophenyl)methoxymethyl]oxolane |
| SMILES | Fc1cccc(COCC2CCCO2)c1 |
| InChI | InChI=1S/C12H15FO2/c13-11-4-1-3-10(7-11)8-14-9-12-5-2-6-15-12/h1,3-4,7,12H,2,5-6,8-9H2 |
| InChIKey | HFZCYANVVHYFTI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |