C13H18N2O2 — CID 168529344
[3-(oxolan-2-ylmethoxymethyl)phenyl]methylidenehydrazine (PubChem CID 168529344) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is [3-(oxolan-2-ylmethoxymethyl)phenyl]methylidenehydrazine.
| Compound Name | [3-(oxolan-2-ylmethoxymethyl)phenyl]methylidenehydrazine |
|---|---|
| PubChem CID | 168529344 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | [3-(oxolan-2-ylmethoxymethyl)phenyl]methylidenehydrazine |
| SMILES | NN=Cc1cccc(COCC2CCCO2)c1 |
| InChI | InChI=1S/C13H18N2O2/c14-15-8-11-3-1-4-12(7-11)9-16-10-13-5-2-6-17-13/h1,3-4,7-8,13H,2,5-6,9-10,14H2 |
| InChIKey | LYPBRVJFBRYFLP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|