C11H14N2O2 — CID 168529970
[3-(1,3-dioxan-2-yl)phenyl]methylidenehydrazine (PubChem CID 168529970) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is [3-(1,3-dioxan-2-yl)phenyl]methylidenehydrazine.
| Compound Name | [3-(1,3-dioxan-2-yl)phenyl]methylidenehydrazine |
|---|---|
| PubChem CID | 168529970 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | [3-(1,3-dioxan-2-yl)phenyl]methylidenehydrazine |
| SMILES | NN=Cc1cccc(C2OCCCO2)c1 |
| InChI | InChI=1S/C11H14N2O2/c12-13-8-9-3-1-4-10(7-9)11-14-5-2-6-15-11/h1,3-4,7-8,11H,2,5-6,12H2 |
| InChIKey | YUVCKPWNZKYJRH-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|