C12H16N2O3 — CID 168530644
[3-[2-(1,3-dioxolan-2-yl)ethoxy]phenyl]methylidenehydrazine (PubChem CID 168530644) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is [3-[2-(1,3-dioxolan-2-yl)ethoxy]phenyl]methylidenehydrazine.
| Compound Name | [3-[2-(1,3-dioxolan-2-yl)ethoxy]phenyl]methylidenehydrazine |
|---|---|
| PubChem CID | 168530644 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | [3-[2-(1,3-dioxolan-2-yl)ethoxy]phenyl]methylidenehydrazine |
| SMILES | NN=Cc1cccc(OCCC2OCCO2)c1 |
| InChI | InChI=1S/C12H16N2O3/c13-14-9-10-2-1-3-11(8-10)15-5-4-12-16-6-7-17-12/h1-3,8-9,12H,4-7,13H2 |
| InChIKey | VQQVAYYNXYGGBQ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|