C12H19N3O — CID 168529091
3-(3-methanehydrazonoylphenoxy)-N,N-dimethylpropan-1-amine (PubChem CID 168529091) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is 3-(3-methanehydrazonoylphenoxy)-N,N-dimethylpropan-1-amine.
| Compound Name | 3-(3-methanehydrazonoylphenoxy)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 168529091 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 3-(3-methanehydrazonoylphenoxy)-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCOc1cccc(C=NN)c1 |
| InChI | InChI=1S/C12H19N3O/c1-15(2)7-4-8-16-12-6-3-5-11(9-12)10-14-13/h3,5-6,9-10H,4,7-8,13H2,1-2H3 |
| InChIKey | XQCWXJZRXIOTLJ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|