C10H15N3 — CID 168530014
1-(3-methanehydrazonoylphenyl)-N,N-dimethylmethanamine (PubChem CID 168530014) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is 1-(3-methanehydrazonoylphenyl)-N,N-dimethylmethanamine.
| Compound Name | 1-(3-methanehydrazonoylphenyl)-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 168530014 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 1-(3-methanehydrazonoylphenyl)-N,N-dimethylmethanamine |
| SMILES | CN(C)Cc1cccc(C=NN)c1 |
| InChI | InChI=1S/C10H15N3/c1-13(2)8-10-5-3-4-9(6-10)7-12-11/h3-7H,8,11H2,1-2H3 |
| InChIKey | WLGLCNUMASEQPQ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|