About 1-(2-methanehydrazonoylphenyl)-N,N-dimethylmethanamine
1-(2-methanehydrazonoylphenyl)-N,N-dimethylmethanamine (PubChem CID 168530555) has the molecular formula C10H15N3
and a molecular weight of 177.25 g/mol. Its IUPAC name is 1-(2-methanehydrazonoylphenyl)-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 1-(2-methanehydrazonoylphenyl)-N,N-dimethylmethanamine |
| PubChem CID | 168530555 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 1-(2-methanehydrazonoylphenyl)-N,N-dimethylmethanamine |
| SMILES | CN(C)Cc1ccccc1C=NN |
| InChI | InChI=1S/C10H15N3/c1-13(2)8-10-6-4-3-5-9(10)7-12-11/h3-7H,8,11H2,1-2H3 |
| InChIKey | HTBBELCVONSJBR-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-methanehydrazonoylphenyl)-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methanehydrazonoylphenyl)-N,N-dimethylmethanamine?
The IUPAC name of 1-(2-methanehydrazonoylphenyl)-N,N-dimethylmethanamine (CID 168530555) is 1-(2-methanehydrazonoylphenyl)-N,N-dimethylmethanamine.
What is the SMILES notation for 1-(2-methanehydrazonoylphenyl)-N,N-dimethylmethanamine?
The canonical SMILES for 1-(2-methanehydrazonoylphenyl)-N,N-dimethylmethanamine is CN(C)Cc1ccccc1C=NN.
What is the InChIKey of 1-(2-methanehydrazonoylphenyl)-N,N-dimethylmethanamine?
The InChIKey is HTBBELCVONSJBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3/c1-13(2)8-10-6-4-3-5-9(10)7-12-11/h3-7H,8,11H2,1-2H3.
What are the key properties of 1-(2-methanehydrazonoylphenyl)-N,N-dimethylmethanamine?
1-(2-methanehydrazonoylphenyl)-N,N-dimethylmethanamine has a molecular weight of 177.25 g/mol, XLogP of 1.04, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methanehydrazonoylphenyl)-N,N-dimethylmethanamine is sourced from PubChem (CID 168530555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).