C15H25N5 — CID 168590766
2-[[2-[(dipropylamino)methyl]phenyl]methylideneamino]guanidine (PubChem CID 168590766) has the molecular formula C15H25N5 and a molecular weight of 275.40 g/mol. Its IUPAC name is 2-[[2-[(dipropylamino)methyl]phenyl]methylideneamino]guanidine.
| Compound Name | 2-[[2-[(dipropylamino)methyl]phenyl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 168590766 |
| Molecular Formula | C15H25N5 |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.21 |
| IUPAC Name | 2-[[2-[(dipropylamino)methyl]phenyl]methylideneamino]guanidine |
| SMILES | CCCN(CCC)Cc1ccccc1C=NN=C(N)N |
| InChI | InChI=1S/C15H25N5/c1-3-9-20(10-4-2)12-14-8-6-5-7-13(14)11-18-19-15(16)17/h5-8,11H,3-4,9-10,12H2,1-2H3,(H4,16,17,19) |
| InChIKey | WPDQNUGFBZUVPQ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|