C15H24N6 — CID 168590834
2-[[2-[(4-ethylpiperazin-1-yl)methyl]phenyl]methylideneamino]guanidine (PubChem CID 168590834) has the molecular formula C15H24N6 and a molecular weight of 288.40 g/mol. Its IUPAC name is 2-[[2-[(4-ethylpiperazin-1-yl)methyl]phenyl]methylideneamino]guanidine.
| Compound Name | 2-[[2-[(4-ethylpiperazin-1-yl)methyl]phenyl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 168590834 |
| Molecular Formula | C15H24N6 |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | 2-[[2-[(4-ethylpiperazin-1-yl)methyl]phenyl]methylideneamino]guanidine |
| SMILES | CCN1CCN(Cc2ccccc2C=NN=C(N)N)CC1 |
| InChI | InChI=1S/C15H24N6/c1-2-20-7-9-21(10-8-20)12-14-6-4-3-5-13(14)11-18-19-15(16)17/h3-6,11H,2,7-10,12H2,1H3,(H4,16,17,19) |
| InChIKey | CNSGJDXSRZTWPW-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 83.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|