C15H16N4O — CID 168591467
2-[[2-(phenoxymethyl)phenyl]methylideneamino]guanidine (PubChem CID 168591467) has the molecular formula C15H16N4O and a molecular weight of 268.32 g/mol. Its IUPAC name is 2-[[2-(phenoxymethyl)phenyl]methylideneamino]guanidine.
| Compound Name | 2-[[2-(phenoxymethyl)phenyl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 168591467 |
| Molecular Formula | C15H16N4O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 2-[[2-(phenoxymethyl)phenyl]methylideneamino]guanidine |
| SMILES | NC(N)=NN=Cc1ccccc1COc1ccccc1 |
| InChI | InChI=1S/C15H16N4O/c16-15(17)19-18-10-12-6-4-5-7-13(12)11-20-14-8-2-1-3-9-14/h1-10H,11H2,(H4,16,17,19) |
| InChIKey | YTXCTFXSORPSLX-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|