C15H14Cl2N4O — CID 168593045
2-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]guanidine (PubChem CID 168593045) has the molecular formula C15H14Cl2N4O and a molecular weight of 337.21 g/mol. Its IUPAC name is 2-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]guanidine.
| Compound Name | 2-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 168593045 |
| Molecular Formula | C15H14Cl2N4O |
| Molecular Weight | 337.21 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 2-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]guanidine |
| SMILES | NC(N)=NN=Cc1ccccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H14Cl2N4O/c16-12-6-5-11(13(17)7-12)9-22-14-4-2-1-3-10(14)8-20-21-15(18)19/h1-8H,9H2,(H4,18,19,21) |
| InChIKey | IGDMKMVOYJQBJD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.21 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|