C15H16Cl2N5O4+ — CID 126960442
2-[(E)-[2-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]guanidine;dihydroxy(oxo)azanium (PubChem CID 126960442) has the molecular formula C15H16Cl2N5O4+ and a molecular weight of 401.23 g/mol. Its IUPAC name is 2-[(E)-[2-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]guanidine;dihydroxy(oxo)azanium.
| Compound Name | 2-[(E)-[2-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]guanidine;dihydroxy(oxo)azanium |
|---|---|
| PubChem CID | 126960442 |
| Molecular Formula | C15H16Cl2N5O4+ |
| Molecular Weight | 401.23 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | 2-[(E)-[2-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]guanidine;dihydroxy(oxo)azanium |
| SMILES | NC(N)=N/N=C/c1ccccc1OCc1ccc(Cl)c(Cl)c1.O=[N+](O)O |
| InChI | InChI=1S/C15H14Cl2N4O.H2NO3/c16-12-6-5-10(7-13(12)17)9-22-14-4-2-1-3-11(14)8-20-21-15(18)19;2-1(3)4/h1-8H,9H2,(H4,18,19,21);(H2,2,3,4)/q;+1/b20-8+; |
| InChIKey | DKLUNANYYFTDPB-MAFYXNADSA-N |
| XLogP | 2.72 |
| TPSA | 146.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.23 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|