C22H19Cl2N3O2 — CID 3899116
1-[[2-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-3-(2-methylphenyl)urea (PubChem CID 3899116) has the molecular formula C22H19Cl2N3O2 and a molecular weight of 428.32 g/mol. Its IUPAC name is 1-[[2-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-3-(2-methylphenyl)urea.
| Compound Name | 1-[[2-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-3-(2-methylphenyl)urea |
|---|---|
| PubChem CID | 3899116 |
| Molecular Formula | C22H19Cl2N3O2 |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | 1-[[2-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-3-(2-methylphenyl)urea |
| SMILES | Cc1ccccc1NC(=O)NN=Cc1ccccc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H19Cl2N3O2/c1-15-6-2-4-8-20(15)26-22(28)27-25-13-17-7-3-5-9-21(17)29-14-16-10-11-18(23)19(24)12-16/h2-13H,14H2,1H3,(H2,26,27,28) |
| InChIKey | XSAYUFGFEPOWEK-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|