C23H17Cl4N3O3 — CID 4241440
N-(2,3-dichlorophenyl)-N'-[[2-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]propanediamide (PubChem CID 4241440) has the molecular formula C23H17Cl4N3O3 and a molecular weight of 525.22 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-N'-[[2-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]propanediamide.
| Compound Name | N-(2,3-dichlorophenyl)-N'-[[2-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]propanediamide |
|---|---|
| PubChem CID | 4241440 |
| Molecular Formula | C23H17Cl4N3O3 |
| Molecular Weight | 525.22 g/mol |
| Exact Mass | 523.00 |
| IUPAC Name | N-(2,3-dichlorophenyl)-N'-[[2-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]propanediamide |
| SMILES | O=C(CC(=O)Nc1cccc(Cl)c1Cl)NN=Cc1ccccc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H17Cl4N3O3/c24-16-9-8-14(10-18(16)26)13-33-20-7-2-1-4-15(20)12-28-30-22(32)11-21(31)29-19-6-3-5-17(25)23(19)27/h1-10,12H,11,13H2,(H,29,31)(H,30,32) |
| InChIKey | TZGOBSRKTFBQTA-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.22 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|