C22H17Cl3N2O2 — CID 19061054
N-[(E)-[5-chloro-2-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-methylbenzamide (PubChem CID 19061054) has the molecular formula C22H17Cl3N2O2 and a molecular weight of 447.75 g/mol. Its IUPAC name is N-[(E)-[5-chloro-2-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-methylbenzamide.
| Compound Name | N-[(E)-[5-chloro-2-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-methylbenzamide |
|---|---|
| PubChem CID | 19061054 |
| Molecular Formula | C22H17Cl3N2O2 |
| Molecular Weight | 447.75 g/mol |
| Exact Mass | 446.04 |
| IUPAC Name | N-[(E)-[5-chloro-2-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)N/N=C/c1cc(Cl)ccc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H17Cl3N2O2/c1-14-4-2-3-5-18(14)22(28)27-26-12-16-11-17(23)7-9-21(16)29-13-15-6-8-19(24)20(25)10-15/h2-12H,13H2,1H3,(H,27,28)/b26-12+ |
| InChIKey | DVQDGWKKBHCLKI-RPPGKUMJSA-N |
| XLogP | 6.30 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.75 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|