C22H19Cl2N3O3 — CID 110340321
2-amino-N-[(E)-[2-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]benzamide (PubChem CID 110340321) has the molecular formula C22H19Cl2N3O3 and a molecular weight of 444.32 g/mol. Its IUPAC name is 2-amino-N-[(E)-[2-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]benzamide.
| Compound Name | 2-amino-N-[(E)-[2-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 110340321 |
| Molecular Formula | C22H19Cl2N3O3 |
| Molecular Weight | 444.32 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | 2-amino-N-[(E)-[2-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]benzamide |
| SMILES | COc1cccc(/C=N/NC(=O)c2ccccc2N)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H19Cl2N3O3/c1-29-20-8-4-5-15(12-26-27-22(28)16-6-2-3-7-19(16)25)21(20)30-13-14-9-10-17(23)18(24)11-14/h2-12H,13,25H2,1H3,(H,27,28)/b26-12+ |
| InChIKey | RWDPZDNBLDMEFQ-RPPGKUMJSA-N |
| XLogP | 4.93 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.32 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|