C22H17BrCl2N2O3 — CID 126085583
N-[(E)-[2-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]benzamide (PubChem CID 126085583) has the molecular formula C22H17BrCl2N2O3 and a molecular weight of 508.20 g/mol. Its IUPAC name is N-[(E)-[2-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]benzamide.
| Compound Name | N-[(E)-[2-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126085583 |
| Molecular Formula | C22H17BrCl2N2O3 |
| Molecular Weight | 508.20 g/mol |
| Exact Mass | 505.98 |
| IUPAC Name | N-[(E)-[2-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]benzamide |
| SMILES | COc1cc(/C=N/NC(=O)c2ccccc2)c(Br)cc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H17BrCl2N2O3/c1-29-20-10-16(12-26-27-22(28)15-5-3-2-4-6-15)17(23)11-21(20)30-13-14-7-8-18(24)19(25)9-14/h2-12H,13H2,1H3,(H,27,28)/b26-12+ |
| InChIKey | IXXODIMYKONXIT-RPPGKUMJSA-N |
| XLogP | 6.11 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.20 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|