C23H19BrClN3O4 — CID 126196560
N-[(Z)-[4-(2-anilino-2-oxoethoxy)-2-bromo-5-methoxyphenyl]methylideneamino]-4-chlorobenzamide (PubChem CID 126196560) has the molecular formula C23H19BrClN3O4 and a molecular weight of 516.78 g/mol. Its IUPAC name is N-[(Z)-[4-(2-anilino-2-oxoethoxy)-2-bromo-5-methoxyphenyl]methylideneamino]-4-chlorobenzamide.
| Compound Name | N-[(Z)-[4-(2-anilino-2-oxoethoxy)-2-bromo-5-methoxyphenyl]methylideneamino]-4-chlorobenzamide |
|---|---|
| PubChem CID | 126196560 |
| Molecular Formula | C23H19BrClN3O4 |
| Molecular Weight | 516.78 g/mol |
| Exact Mass | 515.02 |
| IUPAC Name | N-[(Z)-[4-(2-anilino-2-oxoethoxy)-2-bromo-5-methoxyphenyl]methylideneamino]-4-chlorobenzamide |
| SMILES | COc1cc(/C=N\NC(=O)c2ccc(Cl)cc2)c(Br)cc1OCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C23H19BrClN3O4/c1-31-20-11-16(13-26-28-23(30)15-7-9-17(25)10-8-15)19(24)12-21(20)32-14-22(29)27-18-5-3-2-4-6-18/h2-13H,14H2,1H3,(H,27,29)(H,28,30)/b26-13- |
| InChIKey | WTHYWQNKKNMLIN-ZMFRSBBQSA-N |
| XLogP | 4.89 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.78 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|