C18H16BrClN2O5 — CID 126195572
methyl 2-[5-bromo-4-[(Z)-[(4-chlorobenzoyl)hydrazinylidene]methyl]-2-methoxyphenoxy]acetate (PubChem CID 126195572) has the molecular formula C18H16BrClN2O5 and a molecular weight of 455.69 g/mol. Its IUPAC name is methyl 2-[5-bromo-4-[(Z)-[(4-chlorobenzoyl)hydrazinylidene]methyl]-2-methoxyphenoxy]acetate.
| Compound Name | methyl 2-[5-bromo-4-[(Z)-[(4-chlorobenzoyl)hydrazinylidene]methyl]-2-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 126195572 |
| Molecular Formula | C18H16BrClN2O5 |
| Molecular Weight | 455.69 g/mol |
| Exact Mass | 453.99 |
| IUPAC Name | methyl 2-[5-bromo-4-[(Z)-[(4-chlorobenzoyl)hydrazinylidene]methyl]-2-methoxyphenoxy]acetate |
| SMILES | COC(=O)COc1cc(Br)c(/C=N\NC(=O)c2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C18H16BrClN2O5/c1-25-15-7-12(14(19)8-16(15)27-10-17(23)26-2)9-21-22-18(24)11-3-5-13(20)6-4-11/h3-9H,10H2,1-2H3,(H,22,24)/b21-9- |
| InChIKey | JHWOSJUOWUMRQZ-NKVSQWTQSA-N |
| XLogP | 3.43 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.69 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|