C28H25BrClN3O3 — CID 5134261
N-[[2-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-4-(2,5-dimethylpyrrol-1-yl)benzamide (PubChem CID 5134261) has the molecular formula C28H25BrClN3O3 and a molecular weight of 566.88 g/mol. Its IUPAC name is N-[[2-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-4-(2,5-dimethylpyrrol-1-yl)benzamide.
| Compound Name | N-[[2-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-4-(2,5-dimethylpyrrol-1-yl)benzamide |
|---|---|
| PubChem CID | 5134261 |
| Molecular Formula | C28H25BrClN3O3 |
| Molecular Weight | 566.88 g/mol |
| Exact Mass | 565.08 |
| IUPAC Name | N-[[2-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-4-(2,5-dimethylpyrrol-1-yl)benzamide |
| SMILES | COc1cc(C=NNC(=O)c2ccc(-n3c(C)ccc3C)cc2)c(Br)cc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H25BrClN3O3/c1-18-4-5-19(2)33(18)24-12-8-21(9-13-24)28(34)32-31-16-22-14-26(35-3)27(15-25(22)29)36-17-20-6-10-23(30)11-7-20/h4-16H,17H2,1-3H3,(H,32,34) |
| InChIKey | PSBTZFZZXBUOAE-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.88 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|