C24H21ClN2O6 — CID 126332446
4-[[4-chloro-2-[(E)-[(3,4-dimethoxybenzoyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid (PubChem CID 126332446) has the molecular formula C24H21ClN2O6 and a molecular weight of 468.89 g/mol. Its IUPAC name is 4-[[4-chloro-2-[(E)-[(3,4-dimethoxybenzoyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-chloro-2-[(E)-[(3,4-dimethoxybenzoyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126332446 |
| Molecular Formula | C24H21ClN2O6 |
| Molecular Weight | 468.89 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | 4-[[4-chloro-2-[(E)-[(3,4-dimethoxybenzoyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid |
| SMILES | COc1ccc(C(=O)N/N=C/c2cc(Cl)ccc2OCc2ccc(C(=O)O)cc2)cc1OC |
| InChI | InChI=1S/C24H21ClN2O6/c1-31-21-9-7-17(12-22(21)32-2)23(28)27-26-13-18-11-19(25)8-10-20(18)33-14-15-3-5-16(6-4-15)24(29)30/h3-13H,14H2,1-2H3,(H,27,28)(H,29,30)/b26-13+ |
| InChIKey | JNBZXXFHTUJZLX-LGJNPRDNSA-N |
| XLogP | 4.40 |
| TPSA | 106.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.89 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|