C26H27ClN2O4 — CID 126315344
N-[(E)-[5-chloro-2-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-3,4-diethoxybenzamide (PubChem CID 126315344) has the molecular formula C26H27ClN2O4 and a molecular weight of 466.97 g/mol. Its IUPAC name is N-[(E)-[5-chloro-2-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-3,4-diethoxybenzamide.
| Compound Name | N-[(E)-[5-chloro-2-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-3,4-diethoxybenzamide |
|---|---|
| PubChem CID | 126315344 |
| Molecular Formula | C26H27ClN2O4 |
| Molecular Weight | 466.97 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | N-[(E)-[5-chloro-2-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-3,4-diethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)N/N=C/c2cc(Cl)ccc2OCc2ccc(C)cc2)cc1OCC |
| InChI | InChI=1S/C26H27ClN2O4/c1-4-31-24-12-10-20(15-25(24)32-5-2)26(30)29-28-16-21-14-22(27)11-13-23(21)33-17-19-8-6-18(3)7-9-19/h6-16H,4-5,17H2,1-3H3,(H,29,30)/b28-16+ |
| InChIKey | CSGGARZAKFYRRE-LQKURTRISA-N |
| XLogP | 5.79 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.97 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|