C26H24N2O6 — CID 126328863
4-[[2-[(E)-[(3-methoxy-4-prop-2-enoxybenzoyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid (PubChem CID 126328863) has the molecular formula C26H24N2O6 and a molecular weight of 460.49 g/mol. Its IUPAC name is 4-[[2-[(E)-[(3-methoxy-4-prop-2-enoxybenzoyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-[(E)-[(3-methoxy-4-prop-2-enoxybenzoyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126328863 |
| Molecular Formula | C26H24N2O6 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 4-[[2-[(E)-[(3-methoxy-4-prop-2-enoxybenzoyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid |
| SMILES | C=CCOc1ccc(C(=O)N/N=C/c2ccccc2OCc2ccc(C(=O)O)cc2)cc1OC |
| InChI | InChI=1S/C26H24N2O6/c1-3-14-33-23-13-12-20(15-24(23)32-2)25(29)28-27-16-21-6-4-5-7-22(21)34-17-18-8-10-19(11-9-18)26(30)31/h3-13,15-16H,1,14,17H2,2H3,(H,28,29)(H,30,31)/b27-16+ |
| InChIKey | LOCASWVYNKVEMQ-JVWAILMASA-N |
| XLogP | 4.30 |
| TPSA | 106.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|