C20H16N2O5 — CID 3874055
4-[[2-[(furan-2-carbonylhydrazinylidene)methyl]phenoxy]methyl]benzoic acid (PubChem CID 3874055) has the molecular formula C20H16N2O5 and a molecular weight of 364.36 g/mol. Its IUPAC name is 4-[[2-[(furan-2-carbonylhydrazinylidene)methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-[(furan-2-carbonylhydrazinylidene)methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 3874055 |
| Molecular Formula | C20H16N2O5 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 4-[[2-[(furan-2-carbonylhydrazinylidene)methyl]phenoxy]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(COc2ccccc2C=NNC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C20H16N2O5/c23-19(18-6-3-11-26-18)22-21-12-16-4-1-2-5-17(16)27-13-14-7-9-15(10-8-14)20(24)25/h1-12H,13H2,(H,22,23)(H,24,25) |
| InChIKey | PUGDODRKUQFJJX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|