C25H22Cl2N2O4 — CID 126323010
N-[(E)-[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-3-methoxy-4-prop-2-enoxybenzamide (PubChem CID 126323010) has the molecular formula C25H22Cl2N2O4 and a molecular weight of 485.37 g/mol. Its IUPAC name is N-[(E)-[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-3-methoxy-4-prop-2-enoxybenzamide.
| Compound Name | N-[(E)-[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-3-methoxy-4-prop-2-enoxybenzamide |
|---|---|
| PubChem CID | 126323010 |
| Molecular Formula | C25H22Cl2N2O4 |
| Molecular Weight | 485.37 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | N-[(E)-[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-3-methoxy-4-prop-2-enoxybenzamide |
| SMILES | C=CCOc1ccc(C(=O)N/N=C/c2ccccc2OCc2ccc(Cl)cc2Cl)cc1OC |
| InChI | InChI=1S/C25H22Cl2N2O4/c1-3-12-32-23-11-9-17(13-24(23)31-2)25(30)29-28-15-18-6-4-5-7-22(18)33-16-19-8-10-20(26)14-21(19)27/h3-11,13-15H,1,12,16H2,2H3,(H,29,30)/b28-15+ |
| InChIKey | NKYJOFOIKGJFCS-RWPZCVJISA-N |
| XLogP | 5.91 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.37 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|