C29H25ClN2O4 — CID 126332827
N-[(E)-[5-chloro-2-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-3-methoxy-4-prop-2-enoxybenzamide (PubChem CID 126332827) has the molecular formula C29H25ClN2O4 and a molecular weight of 500.98 g/mol. Its IUPAC name is N-[(E)-[5-chloro-2-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-3-methoxy-4-prop-2-enoxybenzamide.
| Compound Name | N-[(E)-[5-chloro-2-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-3-methoxy-4-prop-2-enoxybenzamide |
|---|---|
| PubChem CID | 126332827 |
| Molecular Formula | C29H25ClN2O4 |
| Molecular Weight | 500.98 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | N-[(E)-[5-chloro-2-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-3-methoxy-4-prop-2-enoxybenzamide |
| SMILES | C=CCOc1ccc(C(=O)N/N=C/c2cc(Cl)ccc2OCc2cccc3ccccc23)cc1OC |
| InChI | InChI=1S/C29H25ClN2O4/c1-3-15-35-27-13-11-21(17-28(27)34-2)29(33)32-31-18-23-16-24(30)12-14-26(23)36-19-22-9-6-8-20-7-4-5-10-25(20)22/h3-14,16-18H,1,15,19H2,2H3,(H,32,33)/b31-18+ |
| InChIKey | NBYVKTPBXZMOBX-FDAWAROLSA-N |
| XLogP | 6.41 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.98 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|