C28H25ClN2O3 — CID 133169709
N-[(E)-[5-chloro-2-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-4-propoxybenzamide (PubChem CID 133169709) has the molecular formula C28H25ClN2O3 and a molecular weight of 472.97 g/mol. Its IUPAC name is N-[(E)-[5-chloro-2-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-4-propoxybenzamide.
| Compound Name | N-[(E)-[5-chloro-2-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-4-propoxybenzamide |
|---|---|
| PubChem CID | 133169709 |
| Molecular Formula | C28H25ClN2O3 |
| Molecular Weight | 472.97 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | N-[(E)-[5-chloro-2-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-4-propoxybenzamide |
| SMILES | CCCOc1ccc(C(=O)N/N=C/c2cc(Cl)ccc2OCc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C28H25ClN2O3/c1-2-16-33-25-13-10-21(11-14-25)28(32)31-30-18-23-17-24(29)12-15-27(23)34-19-22-8-5-7-20-6-3-4-9-26(20)22/h3-15,17-18H,2,16,19H2,1H3,(H,31,32)/b30-18+ |
| InChIKey | AWWDFFNWUGRSAP-UXHLAJHPSA-N |
| XLogP | 6.62 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.97 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|