C25H22ClN3O3 — CID 92659078
N-[(Z)-[5-chloro-2-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-4-propoxybenzamide (PubChem CID 92659078) has the molecular formula C25H22ClN3O3 and a molecular weight of 447.92 g/mol. Its IUPAC name is N-[(Z)-[5-chloro-2-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-4-propoxybenzamide.
| Compound Name | N-[(Z)-[5-chloro-2-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-4-propoxybenzamide |
|---|---|
| PubChem CID | 92659078 |
| Molecular Formula | C25H22ClN3O3 |
| Molecular Weight | 447.92 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | N-[(Z)-[5-chloro-2-[(2-cyanophenyl)methoxy]phenyl]methylideneamino]-4-propoxybenzamide |
| SMILES | CCCOc1ccc(C(=O)N/N=C\c2cc(Cl)ccc2OCc2ccccc2C#N)cc1 |
| InChI | InChI=1S/C25H22ClN3O3/c1-2-13-31-23-10-7-18(8-11-23)25(30)29-28-16-21-14-22(26)9-12-24(21)32-17-20-6-4-3-5-19(20)15-27/h3-12,14,16H,2,13,17H2,1H3,(H,29,30)/b28-16- |
| InChIKey | ZDNCCTRSSCKLEZ-NTFVMDSBSA-N |
| XLogP | 5.34 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.92 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|