C28H27ClN4O3 — CID 3598174
4-chloro-N-[1-[2-[[2-[(2-cyanophenyl)methoxy]phenyl]methylidene]hydrazinyl]-4-methyl-1-oxopentan-2-yl]benzamide (PubChem CID 3598174) has the molecular formula C28H27ClN4O3 and a molecular weight of 503.00 g/mol. Its IUPAC name is 4-chloro-N-[1-[2-[[2-[(2-cyanophenyl)methoxy]phenyl]methylidene]hydrazinyl]-4-methyl-1-oxopentan-2-yl]benzamide.
| Compound Name | 4-chloro-N-[1-[2-[[2-[(2-cyanophenyl)methoxy]phenyl]methylidene]hydrazinyl]-4-methyl-1-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 3598174 |
| Molecular Formula | C28H27ClN4O3 |
| Molecular Weight | 503.00 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | 4-chloro-N-[1-[2-[[2-[(2-cyanophenyl)methoxy]phenyl]methylidene]hydrazinyl]-4-methyl-1-oxopentan-2-yl]benzamide |
| SMILES | CC(C)CC(NC(=O)c1ccc(Cl)cc1)C(=O)NN=Cc1ccccc1OCc1ccccc1C#N |
| InChI | InChI=1S/C28H27ClN4O3/c1-19(2)15-25(32-27(34)20-11-13-24(29)14-12-20)28(35)33-31-17-22-8-5-6-10-26(22)36-18-23-9-4-3-7-21(23)16-30/h3-14,17,19,25H,15,18H2,1-2H3,(H,32,34)(H,33,35) |
| InChIKey | GOGOVEMNFJUMIY-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 103.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.00 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|