C22H14ClI2N3O2 — CID 126197816
4-chloro-N-[(Z)-[2-[(2-cyanophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]benzamide (PubChem CID 126197816) has the molecular formula C22H14ClI2N3O2 and a molecular weight of 641.63 g/mol. Its IUPAC name is 4-chloro-N-[(Z)-[2-[(2-cyanophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]benzamide.
| Compound Name | 4-chloro-N-[(Z)-[2-[(2-cyanophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126197816 |
| Molecular Formula | C22H14ClI2N3O2 |
| Molecular Weight | 641.63 g/mol |
| Exact Mass | 640.89 |
| IUPAC Name | 4-chloro-N-[(Z)-[2-[(2-cyanophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]benzamide |
| SMILES | N#Cc1ccccc1COc1c(I)cc(I)cc1/C=N\NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H14ClI2N3O2/c23-18-7-5-14(6-8-18)22(29)28-27-12-17-9-19(24)10-20(25)21(17)30-13-16-4-2-1-3-15(16)11-26/h1-10,12H,13H2,(H,28,29)/b27-12- |
| InChIKey | INXTWEANRHRNMU-PPDIBHTLSA-N |
| XLogP | 5.76 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.63 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|