C25H15I2N3O3S2 — CID 6002921
N-[(5E)-5-[[2-[(2-cyanophenyl)methoxy]-3,5-diiodophenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide (PubChem CID 6002921) has the molecular formula C25H15I2N3O3S2 and a molecular weight of 723.36 g/mol. Its IUPAC name is N-[(5E)-5-[[2-[(2-cyanophenyl)methoxy]-3,5-diiodophenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide.
| Compound Name | N-[(5E)-5-[[2-[(2-cyanophenyl)methoxy]-3,5-diiodophenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 6002921 |
| Molecular Formula | C25H15I2N3O3S2 |
| Molecular Weight | 723.36 g/mol |
| Exact Mass | 722.86 |
| IUPAC Name | N-[(5E)-5-[[2-[(2-cyanophenyl)methoxy]-3,5-diiodophenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
| SMILES | N#Cc1ccccc1COc1c(I)cc(I)cc1/C=C1/SC(=S)N(NC(=O)c2ccccc2)C1=O |
| InChI | InChI=1S/C25H15I2N3O3S2/c26-19-10-18(22(20(27)12-19)33-14-17-9-5-4-8-16(17)13-28)11-21-24(32)30(25(34)35-21)29-23(31)15-6-2-1-3-7-15/h1-12H,14H2,(H,29,31)/b21-11+ |
| InChIKey | CTVVSQPDMNLENN-SRZZPIQSSA-N |
| XLogP | 5.89 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.36 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|