C23H16FI2N3O2 — CID 126261424
N-[(E)-[4-[(2-cyanophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-2-(4-fluorophenyl)acetamide (PubChem CID 126261424) has the molecular formula C23H16FI2N3O2 and a molecular weight of 639.21 g/mol. Its IUPAC name is N-[(E)-[4-[(2-cyanophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[(E)-[4-[(2-cyanophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126261424 |
| Molecular Formula | C23H16FI2N3O2 |
| Molecular Weight | 639.21 g/mol |
| Exact Mass | 638.93 |
| IUPAC Name | N-[(E)-[4-[(2-cyanophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-2-(4-fluorophenyl)acetamide |
| SMILES | N#Cc1ccccc1COc1c(I)cc(/C=N/NC(=O)Cc2ccc(F)cc2)cc1I |
| InChI | InChI=1S/C23H16FI2N3O2/c24-19-7-5-15(6-8-19)11-22(30)29-28-13-16-9-20(25)23(21(26)10-16)31-14-18-4-2-1-3-17(18)12-27/h1-10,13H,11,14H2,(H,29,30)/b28-13+ |
| InChIKey | YPEVNGZTXRCFBK-XODNFHPESA-N |
| XLogP | 5.18 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.21 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|