C22H17BrI2N2O2 — CID 19061261
2-(4-bromophenyl)-N-[(Z)-(3,5-diiodo-4-phenylmethoxyphenyl)methylideneamino]acetamide (PubChem CID 19061261) has the molecular formula C22H17BrI2N2O2 and a molecular weight of 675.10 g/mol. Its IUPAC name is 2-(4-bromophenyl)-N-[(Z)-(3,5-diiodo-4-phenylmethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(4-bromophenyl)-N-[(Z)-(3,5-diiodo-4-phenylmethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 19061261 |
| Molecular Formula | C22H17BrI2N2O2 |
| Molecular Weight | 675.10 g/mol |
| Exact Mass | 673.86 |
| IUPAC Name | 2-(4-bromophenyl)-N-[(Z)-(3,5-diiodo-4-phenylmethoxyphenyl)methylideneamino]acetamide |
| SMILES | O=C(Cc1ccc(Br)cc1)N/N=C\c1cc(I)c(OCc2ccccc2)c(I)c1 |
| InChI | InChI=1S/C22H17BrI2N2O2/c23-18-8-6-15(7-9-18)12-21(28)27-26-13-17-10-19(24)22(20(25)11-17)29-14-16-4-2-1-3-5-16/h1-11,13H,12,14H2,(H,27,28)/b26-13- |
| InChIKey | WBCRPCDLRYDWJE-ZMFRSBBQSA-N |
| XLogP | 5.93 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.10 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|